C30H42O6 — CID 173266980
1-(2,4,6-trimethylbenzoyl)peroxydecyl 2,4,6-trimethylbenzenecarboperoxoate (PubChem CID 173266980) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is 1-(2,4,6-trimethylbenzoyl)peroxydecyl 2,4,6-trimethylbenzenecarboperoxoate.
| Compound Name | 1-(2,4,6-trimethylbenzoyl)peroxydecyl 2,4,6-trimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266980 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 1-(2,4,6-trimethylbenzoyl)peroxydecyl 2,4,6-trimethylbenzenecarboperoxoate |
| SMILES | CCCCCCCCCC(OOC(=O)c1c(C)cc(C)cc1C)OOC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H42O6/c1-8-9-10-11-12-13-14-15-26(33-35-29(31)27-22(4)16-20(2)17-23(27)5)34-36-30(32)28-24(6)18-21(3)19-25(28)7/h16-19,26H,8-15H2,1-7H3 |
| InChIKey | UUGCDBJBRGCCRT-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|