C28H38O10 — CID 173267245
1-(3,4-dimethoxybenzoyl)peroxydecyl 3,4-dimethoxybenzenecarboperoxoate (PubChem CID 173267245) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)peroxydecyl 3,4-dimethoxybenzenecarboperoxoate.
| Compound Name | 1-(3,4-dimethoxybenzoyl)peroxydecyl 3,4-dimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267245 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)peroxydecyl 3,4-dimethoxybenzenecarboperoxoate |
| SMILES | CCCCCCCCCC(OOC(=O)c1ccc(OC)c(OC)c1)OOC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H38O10/c1-6-7-8-9-10-11-12-13-26(35-37-27(29)20-14-16-22(31-2)24(18-20)33-4)36-38-28(30)21-15-17-23(32-3)25(19-21)34-5/h14-19,26H,6-13H2,1-5H3 |
| InChIKey | GMNRFUGUMCABBP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|