C26H38O6Si2 — CID 173266501
1-(4-trimethylsilylbenzoyl)peroxyhexyl 4-trimethylsilylbenzenecarboperoxoate (PubChem CID 173266501) has the molecular formula C26H38O6Si2 and a molecular weight of 502.76 g/mol. Its IUPAC name is 1-(4-trimethylsilylbenzoyl)peroxyhexyl 4-trimethylsilylbenzenecarboperoxoate.
| Compound Name | 1-(4-trimethylsilylbenzoyl)peroxyhexyl 4-trimethylsilylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266501 |
| Molecular Formula | C26H38O6Si2 |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-(4-trimethylsilylbenzoyl)peroxyhexyl 4-trimethylsilylbenzenecarboperoxoate |
| SMILES | CCCCCC(OOC(=O)c1ccc([Si](C)(C)C)cc1)OOC(=O)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C26H38O6Si2/c1-8-9-10-11-24(29-31-25(27)20-12-16-22(17-13-20)33(2,3)4)30-32-26(28)21-14-18-23(19-15-21)34(5,6)7/h12-19,24H,8-11H2,1-7H3 |
| InChIKey | AIMPTCCWCJCRQK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|