C27H40O6Si2 — CID 173267240
[2-ethyl-2-methyl-1-(4-trimethylsilylbenzoyl)peroxybutyl] 4-trimethylsilylbenzenecarboperoxoate (PubChem CID 173267240) has the molecular formula C27H40O6Si2 and a molecular weight of 516.78 g/mol. Its IUPAC name is [2-ethyl-2-methyl-1-(4-trimethylsilylbenzoyl)peroxybutyl] 4-trimethylsilylbenzenecarboperoxoate.
| Compound Name | [2-ethyl-2-methyl-1-(4-trimethylsilylbenzoyl)peroxybutyl] 4-trimethylsilylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267240 |
| Molecular Formula | C27H40O6Si2 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [2-ethyl-2-methyl-1-(4-trimethylsilylbenzoyl)peroxybutyl] 4-trimethylsilylbenzenecarboperoxoate |
| SMILES | CCC(C)(CC)C(OOC(=O)c1ccc([Si](C)(C)C)cc1)OOC(=O)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H40O6Si2/c1-10-27(3,11-2)26(32-30-24(28)20-12-16-22(17-13-20)34(4,5)6)33-31-25(29)21-14-18-23(19-15-21)35(7,8)9/h12-19,26H,10-11H2,1-9H3 |
| InChIKey | WVVDEBAYAVIZSF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|