C23H28O6 — CID 173266680
[1-(4-ethylbenzoyl)peroxy-2,2-dimethylpropyl] 4-ethylbenzenecarboperoxoate (PubChem CID 173266680) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [1-(4-ethylbenzoyl)peroxy-2,2-dimethylpropyl] 4-ethylbenzenecarboperoxoate.
| Compound Name | [1-(4-ethylbenzoyl)peroxy-2,2-dimethylpropyl] 4-ethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266680 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [1-(4-ethylbenzoyl)peroxy-2,2-dimethylpropyl] 4-ethylbenzenecarboperoxoate |
| SMILES | CCc1ccc(C(=O)OOC(OOC(=O)c2ccc(CC)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28O6/c1-6-16-8-12-18(13-9-16)20(24)26-28-22(23(3,4)5)29-27-21(25)19-14-10-17(7-2)11-15-19/h8-15,22H,6-7H2,1-5H3 |
| InChIKey | PKPXTLVWQFOHHS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|