C24H30O10 — CID 173266166
1-(2,5-dimethoxybenzoyl)peroxyhexyl 2,5-dimethoxybenzenecarboperoxoate (PubChem CID 173266166) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is 1-(2,5-dimethoxybenzoyl)peroxyhexyl 2,5-dimethoxybenzenecarboperoxoate.
| Compound Name | 1-(2,5-dimethoxybenzoyl)peroxyhexyl 2,5-dimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266166 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-(2,5-dimethoxybenzoyl)peroxyhexyl 2,5-dimethoxybenzenecarboperoxoate |
| SMILES | CCCCCC(OOC(=O)c1cc(OC)ccc1OC)OOC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C24H30O10/c1-6-7-8-9-22(31-33-23(25)18-14-16(27-2)10-12-20(18)29-4)32-34-24(26)19-15-17(28-3)11-13-21(19)30-5/h10-15,22H,6-9H2,1-5H3 |
| InChIKey | SHMCPCNJISUUFV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|