C17H26O3 — CID 114963735
1-(2,5-dimethoxyphenyl)-3-ethylheptan-1-one (PubChem CID 114963735) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-ethylheptan-1-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-ethylheptan-1-one |
|---|---|
| PubChem CID | 114963735 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-ethylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H26O3/c1-5-7-8-13(6-2)11-16(18)15-12-14(19-3)9-10-17(15)20-4/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | ZRVNZJJMKBQCAG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |