C15H22O3 — CID 115795487
1-(2,5-dimethoxyphenyl)-5-methylhexan-1-one (PubChem CID 115795487) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-methylhexan-1-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-methylhexan-1-one |
|---|---|
| PubChem CID | 115795487 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-methylhexan-1-one |
| SMILES | COc1ccc(OC)c(C(=O)CCCC(C)C)c1 |
| InChI | InChI=1S/C15H22O3/c1-11(2)6-5-7-14(16)13-10-12(17-3)8-9-15(13)18-4/h8-11H,5-7H2,1-4H3 |
| InChIKey | DYTVOQMFAJZTDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |