6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid

C15H20O5 — CID 70041189

IUPAC6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid
SMILESCOc1ccc(OC)c(C(=O)CCCC(C)C(=O)O)c1
InChIInChI=1S/C15H20O5/c1-10(15(17)18)5-4-6-13(16)12-9-11(19-2)7-8-14(12)20-3/h7-10H,4-6H2,1-3H3,(H,17,18)
InChIKeyUQHLHOHICBIILE-UHFFFAOYSA-N
MW280.32 g/mol
LogP2.78
Rot. Bonds8

About 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid

6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid (PubChem CID 70041189) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid.

Molecular Properties

Compound Name6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid
PubChem CID70041189
Molecular FormulaC15H20O5
Molecular Weight280.32 g/mol
Exact Mass280.13
IUPAC Name6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid
SMILESCOc1ccc(OC)c(C(=O)CCCC(C)C(=O)O)c1
InChIInChI=1S/C15H20O5/c1-10(15(17)18)5-4-6-13(16)12-9-11(19-2)7-8-14(12)20-3/h7-10H,4-6H2,1-3H3,(H,17,18)
InChIKeyUQHLHOHICBIILE-UHFFFAOYSA-N
XLogP2.78
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid?
The IUPAC name of 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid (CID 70041189) is 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid.
What is the SMILES notation for 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid?
The canonical SMILES for 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid is COc1ccc(OC)c(C(=O)CCCC(C)C(=O)O)c1.
What is the InChIKey of 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid?
The InChIKey is UQHLHOHICBIILE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5/c1-10(15(17)18)5-4-6-13(16)12-9-11(19-2)7-8-14(12)20-3/h7-10H,4-6H2,1-3H3,(H,17,18).
What are the key properties of 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid?
6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid has a molecular weight of 280.32 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethoxyphenyl)-2-methyl-6-oxohexanoic acid is sourced from PubChem (CID 70041189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).