C19H30O4 — CID 66702447
2-ethylhexyl 3-(2,5-dimethoxyphenyl)propanoate (PubChem CID 66702447) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-ethylhexyl 3-(2,5-dimethoxyphenyl)propanoate.
| Compound Name | 2-ethylhexyl 3-(2,5-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 66702447 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-ethylhexyl 3-(2,5-dimethoxyphenyl)propanoate |
| SMILES | CCCCC(CC)COC(=O)CCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H30O4/c1-5-7-8-15(6-2)14-23-19(20)12-9-16-13-17(21-3)10-11-18(16)22-4/h10-11,13,15H,5-9,12,14H2,1-4H3 |
| InChIKey | KAMSXPUYRBZPAQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |