C26H42O5 — CID 57424016
bis(2-ethylhexyl) 2-(4-methoxyphenyl)propanedioate (PubChem CID 57424016) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-(4-methoxyphenyl)propanedioate.
| Compound Name | bis(2-ethylhexyl) 2-(4-methoxyphenyl)propanedioate |
|---|---|
| PubChem CID | 57424016 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | bis(2-ethylhexyl) 2-(4-methoxyphenyl)propanedioate |
| SMILES | CCCCC(CC)COC(=O)C(C(=O)OCC(CC)CCCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H42O5/c1-6-10-12-20(8-3)18-30-25(27)24(22-14-16-23(29-5)17-15-22)26(28)31-19-21(9-4)13-11-7-2/h14-17,20-21,24H,6-13,18-19H2,1-5H3 |
| InChIKey | MPCYTQGBDPHDHJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|