C30H44O8 — CID 88978991
2-ethylhexyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate (PubChem CID 88978991) has the molecular formula C30H44O8 and a molecular weight of 532.67 g/mol. Its IUPAC name is 2-ethylhexyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate.
| Compound Name | 2-ethylhexyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 88978991 |
| Molecular Formula | C30H44O8 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2-ethylhexyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate |
| SMILES | CCCCC(CC)COC(=O)C(O)(C(OCC)OCC)C(O)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H44O8/c1-7-11-12-22(8-2)21-38-27(31)30(33,28(36-9-3)37-10-4)29(32,23-13-17-25(34-5)18-14-23)24-15-19-26(35-6)20-16-24/h13-20,22,28,32-33H,7-12,21H2,1-6H3 |
| InChIKey | WUVDYEQGPBDFEM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|