C29H42O8 — CID 123380464
2-ethylpentyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate (PubChem CID 123380464) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-ethylpentyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate.
| Compound Name | 2-ethylpentyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 123380464 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-ethylpentyl 2-(diethoxymethyl)-2,3-dihydroxy-3,3-bis(4-methoxyphenyl)propanoate |
| SMILES | CCCC(CC)COC(=O)C(O)(C(OCC)OCC)C(O)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H42O8/c1-7-11-21(8-2)20-37-26(30)29(32,27(35-9-3)36-10-4)28(31,22-12-16-24(33-5)17-13-22)23-14-18-25(34-6)19-15-23/h12-19,21,27,31-32H,7-11,20H2,1-6H3 |
| InChIKey | XPZWJFPJNNSXFD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|