C16H24O6 — CID 174542706
diethyl 2-methylpropanedioate;1,4-dimethoxybenzene (PubChem CID 174542706) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is diethyl 2-methylpropanedioate;1,4-dimethoxybenzene.
| Compound Name | diethyl 2-methylpropanedioate;1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 174542706 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | diethyl 2-methylpropanedioate;1,4-dimethoxybenzene |
| SMILES | CCOC(=O)C(C)C(=O)OCC.COc1ccc(OC)cc1 |
| InChI | InChI=1S/C8H14O4.C8H10O2/c1-4-11-7(9)6(3)8(10)12-5-2;1-9-7-3-5-8(10-2)6-4-7/h6H,4-5H2,1-3H3;3-6H,1-2H3 |
| InChIKey | DPRBKDWNKBZZQM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|