C30H38O10 — CID 10602909
tetraethyl (2R,3S)-2,3-bis(4-methoxyphenyl)butane-1,1,4,4-tetracarboxylate (PubChem CID 10602909) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is tetraethyl (2R,3S)-2,3-bis(4-methoxyphenyl)butane-1,1,4,4-tetracarboxylate.
| Compound Name | tetraethyl (2R,3S)-2,3-bis(4-methoxyphenyl)butane-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 10602909 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | tetraethyl (2R,3S)-2,3-bis(4-methoxyphenyl)butane-1,1,4,4-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](c1ccc(OC)cc1)[C@H](c1ccc(OC)cc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C30H38O10/c1-7-37-27(31)25(28(32)38-8-2)23(19-11-15-21(35-5)16-12-19)24(20-13-17-22(36-6)18-14-20)26(29(33)39-9-3)30(34)40-10-4/h11-18,23-26H,7-10H2,1-6H3/t23-,24-/m0/s1 |
| InChIKey | REQBDYVKMWPWNC-ZEQRLZLVSA-N |
| XLogP | 4.06 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|