C18H25NO7 — CID 7323007
diethyl 2-[(S)-(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]propanedioate (PubChem CID 7323007) has the molecular formula C18H25NO7 and a molecular weight of 367.40 g/mol. Its IUPAC name is diethyl 2-[(S)-(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(S)-(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 7323007 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | diethyl 2-[(S)-(ethoxycarbonylamino)-(4-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)N[C@H](c1ccc(OC)cc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H25NO7/c1-5-24-16(20)14(17(21)25-6-2)15(19-18(22)26-7-3)12-8-10-13(23-4)11-9-12/h8-11,14-15H,5-7H2,1-4H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | NMKWGZMXCDQCLY-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|