C15H19NO5 — CID 102207453
methyl (2R)-2-[(S)-acetamido-(4-methoxyphenyl)methyl]-3-oxobutanoate (PubChem CID 102207453) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl (2R)-2-[(S)-acetamido-(4-methoxyphenyl)methyl]-3-oxobutanoate.
| Compound Name | methyl (2R)-2-[(S)-acetamido-(4-methoxyphenyl)methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 102207453 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl (2R)-2-[(S)-acetamido-(4-methoxyphenyl)methyl]-3-oxobutanoate |
| SMILES | COC(=O)[C@@H](C(C)=O)[C@H](NC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H19NO5/c1-9(17)13(15(19)21-4)14(16-10(2)18)11-5-7-12(20-3)8-6-11/h5-8,13-14H,1-4H3,(H,16,18)/t13-,14+/m0/s1 |
| InChIKey | CUKIWTNRLONPQL-UONOGXRCSA-N |
| XLogP | 1.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|