C22H22O8 — CID 11165893
dimethyl 2,5-bis(4-methoxyphenyl)-3,4-dioxohexanedioate (PubChem CID 11165893) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is dimethyl 2,5-bis(4-methoxyphenyl)-3,4-dioxohexanedioate.
| Compound Name | dimethyl 2,5-bis(4-methoxyphenyl)-3,4-dioxohexanedioate |
|---|---|
| PubChem CID | 11165893 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | dimethyl 2,5-bis(4-methoxyphenyl)-3,4-dioxohexanedioate |
| SMILES | COC(=O)C(C(=O)C(=O)C(C(=O)OC)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22O8/c1-27-15-9-5-13(6-10-15)17(21(25)29-3)19(23)20(24)18(22(26)30-4)14-7-11-16(28-2)12-8-14/h5-12,17-18H,1-4H3 |
| InChIKey | BJIIGROSTKKSLI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|