methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate

C17H18O4S — CID 132582668

IUPACmethyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate
SMILESCOC(=O)C(Sc1ccc(OC)cc1)c1ccc(OC)cc1
InChIInChI=1S/C17H18O4S/c1-19-13-6-4-12(5-7-13)16(17(18)21-3)22-15-10-8-14(20-2)9-11-15/h4-11,16H,1-3H3
InChIKeyJLUDGQVOLKCZRM-UHFFFAOYSA-N
MW318.39 g/mol
LogP3.71
Rot. Bonds6

About methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate

methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 132582668) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate.

Molecular Properties

Compound Namemethyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate
PubChem CID132582668
Molecular FormulaC17H18O4S
Molecular Weight318.39 g/mol
Exact Mass318.09
IUPAC Namemethyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate
SMILESCOC(=O)C(Sc1ccc(OC)cc1)c1ccc(OC)cc1
InChIInChI=1S/C17H18O4S/c1-19-13-6-4-12(5-7-13)16(17(18)21-3)22-15-10-8-14(20-2)9-11-15/h4-11,16H,1-3H3
InChIKeyJLUDGQVOLKCZRM-UHFFFAOYSA-N
XLogP3.71
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.39
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate?
The IUPAC name of methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate (CID 132582668) is methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate.
What is the SMILES notation for methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate?
The canonical SMILES for methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate is COC(=O)C(Sc1ccc(OC)cc1)c1ccc(OC)cc1.
What is the InChIKey of methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate?
The InChIKey is JLUDGQVOLKCZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4S/c1-19-13-6-4-12(5-7-13)16(17(18)21-3)22-15-10-8-14(20-2)9-11-15/h4-11,16H,1-3H3.
What are the key properties of methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate?
methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate has a molecular weight of 318.39 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfanylacetate is sourced from PubChem (CID 132582668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).