C20H22O3S — CID 175065739
cyclopentyl 2-(4-methoxyphenyl)sulfanyl-2-phenylacetate (PubChem CID 175065739) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is cyclopentyl 2-(4-methoxyphenyl)sulfanyl-2-phenylacetate.
| Compound Name | cyclopentyl 2-(4-methoxyphenyl)sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 175065739 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | cyclopentyl 2-(4-methoxyphenyl)sulfanyl-2-phenylacetate |
| SMILES | COc1ccc(SC(C(=O)OC2CCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O3S/c1-22-16-11-13-18(14-12-16)24-19(15-7-3-2-4-8-15)20(21)23-17-9-5-6-10-17/h2-4,7-8,11-14,17,19H,5-6,9-10H2,1H3 |
| InChIKey | QLZYVEQUWYMQDW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |