C22H26O3S — CID 100941161
cyclohexyl (2R,3R)-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanoate (PubChem CID 100941161) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is cyclohexyl (2R,3R)-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanoate.
| Compound Name | cyclohexyl (2R,3R)-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanoate |
|---|---|
| PubChem CID | 100941161 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | cyclohexyl (2R,3R)-3-hydroxy-3-phenyl-2-(phenylsulfanylmethyl)propanoate |
| SMILES | O=C(OC1CCCCC1)[C@H](CSc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H26O3S/c23-21(17-10-4-1-5-11-17)20(16-26-19-14-8-3-9-15-19)22(24)25-18-12-6-2-7-13-18/h1,3-5,8-11,14-15,18,20-21,23H,2,6-7,12-13,16H2/t20-,21+/m1/s1 |
| InChIKey | INMVEODRIZEFFG-RTWAWAEBSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |