C20H32O3Si — CID 10450451
cyclopentyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-3-phenylpropanoate (PubChem CID 10450451) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is cyclopentyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-3-phenylpropanoate.
| Compound Name | cyclopentyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10450451 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | cyclopentyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]-3-hydroxy-3-phenylpropanoate |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H](C(=O)OC1CCCC1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H32O3Si/c1-20(2,3)24(4,5)18(17(21)15-11-7-6-8-12-15)19(22)23-16-13-9-10-14-16/h6-8,11-12,16-18,21H,9-10,13-14H2,1-5H3/t17-,18-/m1/s1 |
| InChIKey | LEJSTIMLRSCFME-QZTJIDSGSA-N |
| XLogP | 5.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|