C12H18O3Si — CID 10988339
(2S,3S)-3-hydroxy-3-phenyl-2-trimethylsilylpropanoic acid (PubChem CID 10988339) has the molecular formula C12H18O3Si and a molecular weight of 238.36 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-3-phenyl-2-trimethylsilylpropanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-3-phenyl-2-trimethylsilylpropanoic acid |
|---|---|
| PubChem CID | 10988339 |
| Molecular Formula | C12H18O3Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2S,3S)-3-hydroxy-3-phenyl-2-trimethylsilylpropanoic acid |
| SMILES | C[Si](C)(C)[C@H](C(=O)O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3Si/c1-16(2,3)11(12(14)15)10(13)9-7-5-4-6-8-9/h4-8,10-11,13H,1-3H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | QDYNKTAEBCWYSK-QWRGUYRKSA-N |
| XLogP | 2.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|