C16H22O8S2 — CID 57363902
1,2-diphenylethane-1,2-diol;methanesulfonic acid (PubChem CID 57363902) has the molecular formula C16H22O8S2 and a molecular weight of 406.48 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-diol;methanesulfonic acid.
| Compound Name | 1,2-diphenylethane-1,2-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 57363902 |
| Molecular Formula | C16H22O8S2 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 1,2-diphenylethane-1,2-diol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.OC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2.2CH4O3S/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;2*1-5(2,3)4/h1-10,13-16H;2*1H3,(H,2,3,4) |
| InChIKey | TZMUJSHKELJLQU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|