C18H28N2O8S — CID 138397343
bis(2-amino-1-phenylpropane-1,3-diol);sulfuric acid (PubChem CID 138397343) has the molecular formula C18H28N2O8S and a molecular weight of 432.50 g/mol. Its IUPAC name is bis(2-amino-1-phenylpropane-1,3-diol);sulfuric acid.
| Compound Name | bis(2-amino-1-phenylpropane-1,3-diol);sulfuric acid |
|---|---|
| PubChem CID | 138397343 |
| Molecular Formula | C18H28N2O8S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | bis(2-amino-1-phenylpropane-1,3-diol);sulfuric acid |
| SMILES | NC(CO)C(O)c1ccccc1.NC(CO)C(O)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H13NO2.H2O4S/c2*10-8(6-11)9(12)7-4-2-1-3-5-7;1-5(2,3)4/h2*1-5,8-9,11-12H,6,10H2;(H2,1,2,3,4) |
| InChIKey | AZRSQZZERQKEJQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|