C10H15NO — CID 36689126
(1S,2S)-2-amino-1-phenylbutan-1-ol (PubChem CID 36689126) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-phenylbutan-1-ol.
| Compound Name | (1S,2S)-2-amino-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 36689126 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1S,2S)-2-amino-1-phenylbutan-1-ol |
| SMILES | CC[C@H](N)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-2-9(11)10(12)8-6-4-3-5-7-8/h3-7,9-10,12H,2,11H2,1H3/t9-,10-/m0/s1 |
| InChIKey | UOZNVPFVNBRISY-UWVGGRQHSA-N |
| XLogP | 1.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |