C10H16N2 — CID 10702186
(1S,2R)-1-phenylbutane-1,2-diamine (PubChem CID 10702186) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,2R)-1-phenylbutane-1,2-diamine.
| Compound Name | (1S,2R)-1-phenylbutane-1,2-diamine |
|---|---|
| PubChem CID | 10702186 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1S,2R)-1-phenylbutane-1,2-diamine |
| SMILES | CC[C@@H](N)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C10H16N2/c1-2-9(11)10(12)8-6-4-3-5-7-8/h3-7,9-10H,2,11-12H2,1H3/t9-,10+/m1/s1 |
| InChIKey | UAPMHEYCIXSVSK-ZJUUUORDSA-N |
| XLogP | 1.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |