About 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine
2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine (PubChem CID 159334217) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine |
| PubChem CID | 159334217 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine |
| SMILES | CC(C)C(N)c1ccccc1.CCC(N)c1ccccc1 |
| InChI | InChI=1S/C10H15N.C9H13N/c1-8(2)10(11)9-6-4-3-5-7-9;1-2-9(10)8-6-4-3-5-7-8/h3-8,10H,11H2,1-2H3;3-7,9H,2,10H2,1H3 |
| InChIKey | LFIAXLNIFBEYGJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine?
The IUPAC name of 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine (CID 159334217) is 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine.
What is the SMILES notation for 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine?
The canonical SMILES for 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine is CC(C)C(N)c1ccccc1.CCC(N)c1ccccc1.
What is the InChIKey of 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine?
The InChIKey is LFIAXLNIFBEYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C9H13N/c1-8(2)10(11)9-6-4-3-5-7-9;1-2-9(10)8-6-4-3-5-7-8/h3-8,10H,11H2,1-2H3;3-7,9H,2,10H2,1H3.
What are the key properties of 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine?
2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine has a molecular weight of 284.45 g/mol, XLogP of 4.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-phenylpropan-1-amine;1-phenylpropan-1-amine is sourced from PubChem (CID 159334217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).