About (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one
(1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one (PubChem CID 160648144) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one.
Molecular Properties
| Compound Name | (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one |
| PubChem CID | 160648144 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one |
| SMILES | CCC(=O)c1ccccc1.CC[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C9H13N.C9H10O/c2*1-2-9(10)8-6-4-3-5-7-8/h3-7,9H,2,10H2,1H3;3-7H,2H2,1H3/t9-;/m0./s1 |
| InChIKey | RKBHKPGLNKHJPQ-FVGYRXGTSA-N |
| XLogP | 4.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one?
The IUPAC name of (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one (CID 160648144) is (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one.
What is the SMILES notation for (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one?
The canonical SMILES for (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one is CCC(=O)c1ccccc1.CC[C@H](N)c1ccccc1.
What is the InChIKey of (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one?
The InChIKey is RKBHKPGLNKHJPQ-FVGYRXGTSA-N. The full InChI is InChI=1S/C9H13N.C9H10O/c2*1-2-9(10)8-6-4-3-5-7-8/h3-7,9H,2,10H2,1H3;3-7H,2H2,1H3/t9-;/m0./s1.
What are the key properties of (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one?
(1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one has a molecular weight of 269.39 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenylpropan-1-amine;1-phenylpropan-1-one is sourced from PubChem (CID 160648144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).