C14H14FN — CID 12617058
(1R,2R)-2-fluoro-1,2-diphenylethanamine (PubChem CID 12617058) has the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. Its IUPAC name is (1R,2R)-2-fluoro-1,2-diphenylethanamine.
| Compound Name | (1R,2R)-2-fluoro-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 12617058 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1R,2R)-2-fluoro-1,2-diphenylethanamine |
| SMILES | N[C@H](c1ccccc1)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C14H14FN/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,16H2/t13-,14-/m1/s1 |
| InChIKey | PSMWLVKGJRNYQC-ZIAGYGMSSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |