C14H17N3 — CID 143003712
2-hydrazinyl-1,2-diphenylethanamine (PubChem CID 143003712) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-hydrazinyl-1,2-diphenylethanamine.
| Compound Name | 2-hydrazinyl-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 143003712 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-hydrazinyl-1,2-diphenylethanamine |
| SMILES | NNC(c1ccccc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C14H17N3/c15-13(11-7-3-1-4-8-11)14(17-16)12-9-5-2-6-10-12/h1-10,13-14,17H,15-16H2 |
| InChIKey | UIVALAILHSTDMJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|