C10H10F6N2 — CID 103312705
[3,3,3-trifluoro-1-phenyl-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312705) has the molecular formula C10H10F6N2 and a molecular weight of 272.19 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-phenyl-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [3,3,3-trifluoro-1-phenyl-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312705 |
| Molecular Formula | C10H10F6N2 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [3,3,3-trifluoro-1-phenyl-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(c1ccccc1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2/c11-9(12,13)8(10(14,15)16)7(18-17)6-4-2-1-3-5-6/h1-5,7-8,18H,17H2 |
| InChIKey | JVRJQDFUBNBQPY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|