C12H20N2O2 — CID 10823027
(2,2-diethoxy-1-phenylethyl)hydrazine (PubChem CID 10823027) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2,2-diethoxy-1-phenylethyl)hydrazine.
| Compound Name | (2,2-diethoxy-1-phenylethyl)hydrazine |
|---|---|
| PubChem CID | 10823027 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (2,2-diethoxy-1-phenylethyl)hydrazine |
| SMILES | CCOC(OCC)C(NN)c1ccccc1 |
| InChI | InChI=1S/C12H20N2O2/c1-3-15-12(16-4-2)11(14-13)10-8-6-5-7-9-10/h5-9,11-12,14H,3-4,13H2,1-2H3 |
| InChIKey | SNTIGRIVPWGKHG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|