C21H21N3O — CID 100952143
1-[(1R,2R)-2-amino-1,2-diphenylethyl]-3-phenylurea (PubChem CID 100952143) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(1R,2R)-2-amino-1,2-diphenylethyl]-3-phenylurea.
| Compound Name | 1-[(1R,2R)-2-amino-1,2-diphenylethyl]-3-phenylurea |
|---|---|
| PubChem CID | 100952143 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(1R,2R)-2-amino-1,2-diphenylethyl]-3-phenylurea |
| SMILES | N[C@H](c1ccccc1)[C@H](NC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O/c22-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)24-21(25)23-18-14-8-3-9-15-18/h1-15,19-20H,22H2,(H2,23,24,25)/t19-,20-/m1/s1 |
| InChIKey | DDXYRBTYHPWMPM-WOJBJXKFSA-N |
| XLogP | 4.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |