C22H20F3N3O — CID 57063171
1-[(1R,2S)-2-amino-1,2-diphenylethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 57063171) has the molecular formula C22H20F3N3O and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-[(1R,2S)-2-amino-1,2-diphenylethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1R,2S)-2-amino-1,2-diphenylethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 57063171 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[(1R,2S)-2-amino-1,2-diphenylethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | N[C@@H](c1ccccc1)[C@H](NC(=O)Nc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20F3N3O/c23-22(24,25)17-11-13-18(14-12-17)27-21(29)28-20(16-9-5-2-6-10-16)19(26)15-7-3-1-4-8-15/h1-14,19-20H,26H2,(H2,27,28,29)/t19-,20+/m0/s1 |
| InChIKey | GIOVIMSGUFUYDH-VQTJNVASSA-N |
| XLogP | 5.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |