C33H43F3N4O2 — CID 173354355
1-cyclooctyl-3-[1,2-diphenyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea;methane (PubChem CID 173354355) has the molecular formula C33H43F3N4O2 and a molecular weight of 584.73 g/mol. Its IUPAC name is 1-cyclooctyl-3-[1,2-diphenyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea;methane.
| Compound Name | 1-cyclooctyl-3-[1,2-diphenyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea;methane |
|---|---|
| PubChem CID | 173354355 |
| Molecular Formula | C33H43F3N4O2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 1-cyclooctyl-3-[1,2-diphenyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea;methane |
| SMILES | C.C.O=C(Nc1ccc(C(F)(F)F)cc1)NC(c1ccccc1)C(NC(=O)NC1CCCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C31H35F3N4O2.2CH4/c32-31(33,34)24-18-20-26(21-19-24)36-30(40)38-28(23-14-8-5-9-15-23)27(22-12-6-4-7-13-22)37-29(39)35-25-16-10-2-1-3-11-17-25;;/h4-9,12-15,18-21,25,27-28H,1-3,10-11,16-17H2,(H2,35,37,39)(H2,36,38,40);2*1H4 |
| InChIKey | OROYHFHWQXSCSO-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |