C28H31ClN4O2 — CID 57171555
1-(3-chlorophenyl)-3-[(1R,2S)-2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea (PubChem CID 57171555) has the molecular formula C28H31ClN4O2 and a molecular weight of 491.04 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1R,2S)-2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1R,2S)-2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea |
|---|---|
| PubChem CID | 57171555 |
| Molecular Formula | C28H31ClN4O2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1R,2S)-2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N[C@H](c1ccccc1)[C@@H](NC(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H31ClN4O2/c29-22-15-10-18-24(19-22)31-28(35)33-26(21-13-6-2-7-14-21)25(20-11-4-1-5-12-20)32-27(34)30-23-16-8-3-9-17-23/h1-2,4-7,10-15,18-19,23,25-26H,3,8-9,16-17H2,(H2,30,32,34)(H2,31,33,35)/t25-,26+/m0/s1 |
| InChIKey | REENZHFNLQZTSS-IZZNHLLZSA-N |
| XLogP | 6.58 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |