C15H20ClN3OS — CID 61124429
1-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-(3-chlorophenyl)urea (PubChem CID 61124429) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is 1-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-(3-chlorophenyl)urea.
| Compound Name | 1-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 61124429 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(2-amino-1-cyclohexyl-2-sulfanylideneethyl)-3-(3-chlorophenyl)urea |
| SMILES | NC(=S)C(NC(=O)Nc1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H20ClN3OS/c16-11-7-4-8-12(9-11)18-15(20)19-13(14(17)21)10-5-2-1-3-6-10/h4,7-10,13H,1-3,5-6H2,(H2,17,21)(H2,18,19,20) |
| InChIKey | PZWMZVLGYNFKGK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|