C10H12ClN3OS — CID 61122602
1-(1-amino-1-sulfanylidenepropan-2-yl)-3-(3-chlorophenyl)urea (PubChem CID 61122602) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is 1-(1-amino-1-sulfanylidenepropan-2-yl)-3-(3-chlorophenyl)urea.
| Compound Name | 1-(1-amino-1-sulfanylidenepropan-2-yl)-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 61122602 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(1-amino-1-sulfanylidenepropan-2-yl)-3-(3-chlorophenyl)urea |
| SMILES | CC(NC(=O)Nc1cccc(Cl)c1)C(N)=S |
| InChI | InChI=1S/C10H12ClN3OS/c1-6(9(12)16)13-10(15)14-8-4-2-3-7(11)5-8/h2-6H,1H3,(H2,12,16)(H2,13,14,15) |
| InChIKey | WLLMBRYSCQBEFS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|