C28H25ClN4O2 — CID 54084890
1-(4-chlorophenyl)-3-[(1R,2R)-1,2-diphenyl-2-(phenylcarbamoylamino)ethyl]urea (PubChem CID 54084890) has the molecular formula C28H25ClN4O2 and a molecular weight of 484.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1R,2R)-1,2-diphenyl-2-(phenylcarbamoylamino)ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1R,2R)-1,2-diphenyl-2-(phenylcarbamoylamino)ethyl]urea |
|---|---|
| PubChem CID | 54084890 |
| Molecular Formula | C28H25ClN4O2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1R,2R)-1,2-diphenyl-2-(phenylcarbamoylamino)ethyl]urea |
| SMILES | O=C(Nc1ccccc1)N[C@H](c1ccccc1)[C@H](NC(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H25ClN4O2/c29-22-16-18-24(19-17-22)31-28(35)33-26(21-12-6-2-7-13-21)25(20-10-4-1-5-11-20)32-27(34)30-23-14-8-3-9-15-23/h1-19,25-26H,(H2,30,32,34)(H2,31,33,35)/t25-,26-/m1/s1 |
| InChIKey | MPSWBXCWZBWRDO-CLJLJLNGSA-N |
| XLogP | 6.77 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |