C28H26ClN3O3S — CID 15231970
1-(4-chlorophenyl)-3-[2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]urea (PubChem CID 15231970) has the molecular formula C28H26ClN3O3S and a molecular weight of 520.05 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]urea |
|---|---|
| PubChem CID | 15231970 |
| Molecular Formula | C28H26ClN3O3S |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26ClN3O3S/c1-20-12-18-25(19-13-20)36(34,35)32-27(22-10-6-3-7-11-22)26(21-8-4-2-5-9-21)31-28(33)30-24-16-14-23(29)15-17-24/h2-19,26-27,32H,1H3,(H2,30,31,33) |
| InChIKey | OWODVABCYVHWGD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |