C18H20ClNO2S — CID 11382505
N-[(1S,2S)-1-(4-chlorophenyl)-2-methylbut-3-enyl]-4-methylbenzenesulfonamide (PubChem CID 11382505) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is N-[(1S,2S)-1-(4-chlorophenyl)-2-methylbut-3-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-1-(4-chlorophenyl)-2-methylbut-3-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11382505 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[(1S,2S)-1-(4-chlorophenyl)-2-methylbut-3-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=C[C@H](C)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO2S/c1-4-14(3)18(15-7-9-16(19)10-8-15)20-23(21,22)17-11-5-13(2)6-12-17/h4-12,14,18,20H,1H2,2-3H3/t14-,18-/m0/s1 |
| InChIKey | NFEQIXPRMNSDDF-KSSFIOAISA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|