C19H23NO2S — CID 100938085
4-methyl-N-[(1R,2R)-2-methyl-1-(4-methylphenyl)but-3-enyl]benzenesulfonamide (PubChem CID 100938085) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-methyl-1-(4-methylphenyl)but-3-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-methyl-1-(4-methylphenyl)but-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100938085 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-methyl-1-(4-methylphenyl)but-3-enyl]benzenesulfonamide |
| SMILES | C=C[C@@H](C)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23NO2S/c1-5-16(4)19(17-10-6-14(2)7-11-17)20-23(21,22)18-12-8-15(3)9-13-18/h5-13,16,19-20H,1H2,2-4H3/t16-,19-/m1/s1 |
| InChIKey | SUDIAHXWJLMSOC-VQIMIIECSA-N |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|