C16H23NO4S — CID 101107926
propan-2-yl 3-methyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate (PubChem CID 101107926) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate.
| Compound Name | propan-2-yl 3-methyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 101107926 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | propan-2-yl 3-methyl-2-[(4-methylphenyl)sulfonylamino]pent-4-enoate |
| SMILES | C=CC(C)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C16H23NO4S/c1-6-13(5)15(16(18)21-11(2)3)17-22(19,20)14-9-7-12(4)8-10-14/h6-11,13,15,17H,1H2,2-5H3 |
| InChIKey | YIXVNBXEKWFIEG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|