C12H15NO6S — CID 11141140
dimethyl 2-[(4-methylphenyl)sulfonylamino]propanedioate (PubChem CID 11141140) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is dimethyl 2-[(4-methylphenyl)sulfonylamino]propanedioate.
| Compound Name | dimethyl 2-[(4-methylphenyl)sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 11141140 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | dimethyl 2-[(4-methylphenyl)sulfonylamino]propanedioate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C12H15NO6S/c1-8-4-6-9(7-5-8)20(16,17)13-10(11(14)18-2)12(15)19-3/h4-7,10,13H,1-3H3 |
| InChIKey | QLPLDQMOCLEZLE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|