C18H22N2O6S2 — CID 11133698
ethyl 2,2-bis[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 11133698) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is ethyl 2,2-bis[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | ethyl 2,2-bis[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 11133698 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | ethyl 2,2-bis[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2O6S2/c1-4-26-18(21)17(19-27(22,23)15-9-5-13(2)6-10-15)20-28(24,25)16-11-7-14(3)8-12-16/h5-12,17,19-20H,4H2,1-3H3 |
| InChIKey | HHQMIGAIDFABJY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|