C13H19NO5S — CID 59033490
ethyl (2S,3S)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 59033490) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is ethyl (2S,3S)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | ethyl (2S,3S)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 59033490 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | ethyl (2S,3S)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO5S/c1-4-19-13(16)12(15)10(3)14-20(17,18)11-7-5-9(2)6-8-11/h5-8,10,12,14-15H,4H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | FLGCWQDNNSKORK-JQWIXIFHSA-N |
| XLogP | 0.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |