C17H23NO5S — CID 102487273
ethyl 2-(cyclopropanecarbonyl)-3-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 102487273) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is ethyl 2-(cyclopropanecarbonyl)-3-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | ethyl 2-(cyclopropanecarbonyl)-3-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 102487273 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | ethyl 2-(cyclopropanecarbonyl)-3-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)C(C(=O)C1CC1)C(C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-4-23-17(20)15(16(19)13-7-8-13)12(3)18-24(21,22)14-9-5-11(2)6-10-14/h5-6,9-10,12-13,15,18H,4,7-8H2,1-3H3 |
| InChIKey | SNUKMJKXMXRAQZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|