C18H27NO5S — CID 15533211
ethyl 3-cyclohexyl-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 15533211) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-cyclohexyl-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 15533211 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 3-cyclohexyl-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C18H27NO5S/c1-3-24-18(21)16(17(20)14-7-5-4-6-8-14)19-25(22,23)15-11-9-13(2)10-12-15/h9-12,14,16-17,19-20H,3-8H2,1-2H3 |
| InChIKey | GIFBYQDUCWYWDI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |