C20H29NO5S — CID 102210057
ethyl (2S)-5-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate (PubChem CID 102210057) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is ethyl (2S)-5-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate.
| Compound Name | ethyl (2S)-5-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 102210057 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl (2S)-5-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)C1CCCCC1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H29NO5S/c1-3-26-20(23)18(13-14-19(22)16-7-5-4-6-8-16)21-27(24,25)17-11-9-15(2)10-12-17/h9-12,16,18,21H,3-8,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | VICQXAPZPWBINK-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |